C15H15Cl2N5O4 — CID 10179078
methyl 2-[[1-acetyl-5-amino-7-chloro-2-(furan-2-yl)imidazo[1,2-a]pyrimidin-4-ium-3-yl]amino]acetate chloride (PubChem CID 10179078) has the molecular formula C15H15Cl2N5O4 and a molecular weight of 400.22 g/mol. Its IUPAC name is methyl 2-[[1-acetyl-5-amino-7-chloro-2-(furan-2-yl)imidazo[1,2-a]pyrimidin-4-ium-3-yl]amino]acetate chloride.
| Compound Name | methyl 2-[[1-acetyl-5-amino-7-chloro-2-(furan-2-yl)imidazo[1,2-a]pyrimidin-4-ium-3-yl]amino]acetate chloride |
|---|---|
| PubChem CID | 10179078 |
| Molecular Formula | C15H15Cl2N5O4 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | methyl 2-[[1-acetyl-5-amino-7-chloro-2-(furan-2-yl)imidazo[1,2-a]pyrimidin-4-ium-3-yl]amino]acetate chloride |
| SMILES | COC(=O)CNc1c(-c2ccco2)n(C(C)=O)c2nc(Cl)cc(N)[n+]12.[Cl-] |
| InChI | InChI=1S/C15H14ClN5O4.ClH/c1-8(22)20-13(9-4-3-5-25-9)14(18-7-12(23)24-2)21-11(17)6-10(16)19-15(20)21;/h3-6,17-18H,7H2,1-2H3;1H |
| InChIKey | RUOOKNYYMNZFGT-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|