C23H29FN2O3 — CID 10179120
4-(4-phenylmethoxypiperidin-1-yl)butyl N-(4-fluorophenyl)carbamate (PubChem CID 10179120) has the molecular formula C23H29FN2O3 and a molecular weight of 400.49 g/mol. Its IUPAC name is 4-(4-phenylmethoxypiperidin-1-yl)butyl N-(4-fluorophenyl)carbamate.
| Compound Name | 4-(4-phenylmethoxypiperidin-1-yl)butyl N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 10179120 |
| Molecular Formula | C23H29FN2O3 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-(4-phenylmethoxypiperidin-1-yl)butyl N-(4-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1)OCCCCN1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29FN2O3/c24-20-8-10-21(11-9-20)25-23(27)28-17-5-4-14-26-15-12-22(13-16-26)29-18-19-6-2-1-3-7-19/h1-3,6-11,22H,4-5,12-18H2,(H,25,27) |
| InChIKey | MVZFGRRKRJNJDO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|