C22H31N3O4 — CID 10179188
N-tert-butyl-4,6-dimethoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-triene-17-carboxamide (PubChem CID 10179188) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-tert-butyl-4,6-dimethoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-triene-17-carboxamide.
| Compound Name | N-tert-butyl-4,6-dimethoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-triene-17-carboxamide |
|---|---|
| PubChem CID | 10179188 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | N-tert-butyl-4,6-dimethoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-triene-17-carboxamide |
| SMILES | COc1cc2c(c(OC)c1)C1C3CCCC(C(=O)N1CC2)N3C(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H31N3O4/c1-22(2,3)23-21(27)25-15-7-6-8-16(25)20(26)24-10-9-13-11-14(28-4)12-17(29-5)18(13)19(15)24/h11-12,15-16,19H,6-10H2,1-5H3,(H,23,27) |
| InChIKey | CSRNVIDQXIERPV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |