About 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate
2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate (PubChem CID 10180050) has the molecular formula C24H34N2O4
and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate |
| PubChem CID | 10180050 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(CNc2ccc(C(C)C)cc2)[nH]c(C(=O)OC(C)(C)C)c1CC |
| InChI | InChI=1S/C24H34N2O4/c1-8-18-20(22(27)29-9-2)19(26-21(18)23(28)30-24(5,6)7)14-25-17-12-10-16(11-13-17)15(3)4/h10-13,15,25-26H,8-9,14H2,1-7H3 |
| InChIKey | MPMOCMKSVOTBCV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate?
The IUPAC name of 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate (CID 10180050) is 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate.
What is the SMILES notation for 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate?
The canonical SMILES for 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate is CCOC(=O)c1c(CNc2ccc(C(C)C)cc2)[nH]c(C(=O)OC(C)(C)C)c1CC.
What is the InChIKey of 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate?
The InChIKey is MPMOCMKSVOTBCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O4/c1-8-18-20(22(27)29-9-2)19(26-21(18)23(28)30-24(5,6)7)14-25-17-12-10-16(11-13-17)15(3)4/h10-13,15,25-26H,8-9,14H2,1-7H3.
What are the key properties of 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate?
2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate has a molecular weight of 414.55 g/mol, XLogP of 5.44, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-tert-butyl 4-O-ethyl 3-ethyl-5-[(4-propan-2-ylanilino)methyl]-1H-pyrrole-2,4-dicarboxylate is sourced from PubChem (CID 10180050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).