C23H34N4O3 — CID 10180053
[(2S)-1-[(3-cyano-1-ethylazepan-3-yl)amino]-4-methyl-1-oxopentan-2-yl] N-benzylcarbamate (PubChem CID 10180053) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is [(2S)-1-[(3-cyano-1-ethylazepan-3-yl)amino]-4-methyl-1-oxopentan-2-yl] N-benzylcarbamate.
| Compound Name | [(2S)-1-[(3-cyano-1-ethylazepan-3-yl)amino]-4-methyl-1-oxopentan-2-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 10180053 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [(2S)-1-[(3-cyano-1-ethylazepan-3-yl)amino]-4-methyl-1-oxopentan-2-yl] N-benzylcarbamate |
| SMILES | CCN1CCCCC(C#N)(NC(=O)[C@H](CC(C)C)OC(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C23H34N4O3/c1-4-27-13-9-8-12-23(16-24,17-27)26-21(28)20(14-18(2)3)30-22(29)25-15-19-10-6-5-7-11-19/h5-7,10-11,18,20H,4,8-9,12-15,17H2,1-3H3,(H,25,29)(H,26,28)/t20-,23?/m0/s1 |
| InChIKey | AHNJPQREXKFCQU-AJZOCDQUSA-N |
| XLogP | 3.21 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |