C21H29N5O4 — CID 10180091
2-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-N-methylpyridine-4-carboxamide (PubChem CID 10180091) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-N-methylpyridine-4-carboxamide.
| Compound Name | 2-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 10180091 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 2-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-N-methylpyridine-4-carboxamide |
| SMILES | CNC(=O)c1ccnc(-c2noc([C@H](CCCC3CCCCC3)CC(=O)NO)n2)c1 |
| InChI | InChI=1S/C21H29N5O4/c1-22-20(28)15-10-11-23-17(12-15)19-24-21(30-26-19)16(13-18(27)25-29)9-5-8-14-6-3-2-4-7-14/h10-12,14,16,29H,2-9,13H2,1H3,(H,22,28)(H,25,27)/t16-/m1/s1 |
| InChIKey | GXFOGQOZDTZTCB-MRXNPFEDSA-N |
| XLogP | 3.22 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|