C25H37NO4 — CID 10180111
2-[(E)-butoxymethyliminomethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 10180111) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is 2-[(E)-butoxymethyliminomethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | 2-[(E)-butoxymethyliminomethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 10180111 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 2-[(E)-butoxymethyliminomethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CCCCOC/N=C/C12CC3C(C)CCC3C3(C=O)CC1C=C(C(C)C)C32C(=O)O |
| InChI | InChI=1S/C25H37NO4/c1-5-6-9-30-15-26-13-23-12-19-17(4)7-8-20(19)24(14-27)11-18(23)10-21(16(2)3)25(23,24)22(28)29/h10,13-14,16-20H,5-9,11-12,15H2,1-4H3,(H,28,29)/b26-13+ |
| InChIKey | OHFJWFUVZDYREJ-LGJNPRDNSA-N |
| XLogP | 4.76 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|