About N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide (PubChem CID 10180195) has the molecular formula C18H10F7N3O
and a molecular weight of 417.28 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide.
Molecular Properties
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide |
| PubChem CID | 10180195 |
| Molecular Formula | C18H10F7N3O |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide |
| SMILES | O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H10F7N3O/c19-11-3-1-2-10(8-11)16(29)26-12-4-6-13(7-5-12)28-15(18(23,24)25)9-14(27-28)17(20,21)22/h1-9H,(H,26,29) |
| InChIKey | ABAHDBCDNXMPFY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide?
The IUPAC name of N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide (CID 10180195) is N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide.
What is the SMILES notation for N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide?
The canonical SMILES for N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide is O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1cccc(F)c1.
What is the InChIKey of N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide?
The InChIKey is ABAHDBCDNXMPFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F7N3O/c19-11-3-1-2-10(8-11)16(29)26-12-4-6-13(7-5-12)28-15(18(23,24)25)9-14(27-28)17(20,21)22/h1-9H,(H,26,29).
What are the key properties of N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide?
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide has a molecular weight of 417.28 g/mol, XLogP of 5.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-fluorobenzamide is sourced from PubChem (CID 10180195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).