About 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one
4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one (PubChem CID 10180275) has the molecular formula C19H16F6N2O2
and a molecular weight of 418.34 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one |
| PubChem CID | 10180275 |
| Molecular Formula | C19H16F6N2O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one |
| SMILES | O=C1NCC(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)N1 |
| InChI | InChI=1S/C19H16F6N2O2/c20-18(21,22)14-6-12(7-15(8-14)19(23,24)25)9-29-11-17(10-26-16(28)27-17)13-4-2-1-3-5-13/h1-8H,9-11H2,(H2,26,27,28) |
| InChIKey | PKXHFVKACNEDII-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one?
The IUPAC name of 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one (CID 10180275) is 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one.
What is the SMILES notation for 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one?
The canonical SMILES for 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one is O=C1NCC(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)N1.
What is the InChIKey of 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one?
The InChIKey is PKXHFVKACNEDII-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F6N2O2/c20-18(21,22)14-6-12(7-15(8-14)19(23,24)25)9-29-11-17(10-26-16(28)27-17)13-4-2-1-3-5-13/h1-8H,9-11H2,(H2,26,27,28).
What are the key properties of 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one?
4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one has a molecular weight of 418.34 g/mol, XLogP of 4.45, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylimidazolidin-2-one is sourced from PubChem (CID 10180275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).