C24H34O4S — CID 10180324
[(E)-3-methyl-5-(4-methylphenyl)sulfonyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enyl] acetate (PubChem CID 10180324) has the molecular formula C24H34O4S and a molecular weight of 418.60 g/mol. Its IUPAC name is [(E)-3-methyl-5-(4-methylphenyl)sulfonyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enyl] acetate.
| Compound Name | [(E)-3-methyl-5-(4-methylphenyl)sulfonyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enyl] acetate |
|---|---|
| PubChem CID | 10180324 |
| Molecular Formula | C24H34O4S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | [(E)-3-methyl-5-(4-methylphenyl)sulfonyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H34O4S/c1-17-9-11-21(12-10-17)29(26,27)22(16-18(2)13-15-28-20(4)25)23-19(3)8-7-14-24(23,5)6/h9-13,22H,7-8,14-16H2,1-6H3/b18-13+ |
| InChIKey | AOSSTKQHEUYDPA-QGOAFFKASA-N |
| XLogP | 5.56 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|