C28H25N3O — CID 10180378
6-(4-hydroxynaphthalen-1-yl)-5,6,6a,7,8,12b-hexahydrobenzo[k]phenanthridine-2-carboximidamide (PubChem CID 10180378) has the molecular formula C28H25N3O and a molecular weight of 419.53 g/mol. Its IUPAC name is 6-(4-hydroxynaphthalen-1-yl)-5,6,6a,7,8,12b-hexahydrobenzo[k]phenanthridine-2-carboximidamide.
| Compound Name | 6-(4-hydroxynaphthalen-1-yl)-5,6,6a,7,8,12b-hexahydrobenzo[k]phenanthridine-2-carboximidamide |
|---|---|
| PubChem CID | 10180378 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 6-(4-hydroxynaphthalen-1-yl)-5,6,6a,7,8,12b-hexahydrobenzo[k]phenanthridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C1c3ccccc3CCC1C(c1ccc(O)c3ccccc13)N2 |
| InChI | InChI=1S/C28H25N3O/c29-28(30)17-10-13-24-23(15-17)26-18-6-2-1-5-16(18)9-11-22(26)27(31-24)21-12-14-25(32)20-8-4-3-7-19(20)21/h1-8,10,12-15,22,26-27,31-32H,9,11H2,(H3,29,30) |
| InChIKey | IDHGHCNCFDWGQG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 82.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|