C26H23N3O3 — CID 10180753
6-[3-(3-cyanophenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoic acid (PubChem CID 10180753) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 6-[3-(3-cyanophenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoic acid.
| Compound Name | 6-[3-(3-cyanophenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 10180753 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 6-[3-(3-cyanophenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoic acid |
| SMILES | N#Cc1cccc(-n2c(-c3ccccc3)nc3ccc(OCCCCCC(=O)O)cc32)c1 |
| InChI | InChI=1S/C26H23N3O3/c27-18-19-8-7-11-21(16-19)29-24-17-22(32-15-6-2-5-12-25(30)31)13-14-23(24)28-26(29)20-9-3-1-4-10-20/h1,3-4,7-11,13-14,16-17H,2,5-6,12,15H2,(H,30,31) |
| InChIKey | JTWZEOCPWJHJEX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|