C27H27N3O2 — CID 10180771
1-(5-tert-butyl-2-methylphenyl)-3-(4-pyridin-4-yloxynaphthalen-1-yl)urea (PubChem CID 10180771) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methylphenyl)-3-(4-pyridin-4-yloxynaphthalen-1-yl)urea.
| Compound Name | 1-(5-tert-butyl-2-methylphenyl)-3-(4-pyridin-4-yloxynaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 10180771 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-(5-tert-butyl-2-methylphenyl)-3-(4-pyridin-4-yloxynaphthalen-1-yl)urea |
| SMILES | Cc1ccc(C(C)(C)C)cc1NC(=O)Nc1ccc(Oc2ccncc2)c2ccccc12 |
| InChI | InChI=1S/C27H27N3O2/c1-18-9-10-19(27(2,3)4)17-24(18)30-26(31)29-23-11-12-25(22-8-6-5-7-21(22)23)32-20-13-15-28-16-14-20/h5-17H,1-4H3,(H2,29,30,31) |
| InChIKey | WQCKNOHLEAQFAP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |