C23H32N4O4 — CID 10180993
N-benzyl-5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-methyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 10180993) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-benzyl-5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-methyl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-benzyl-5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-methyl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 10180993 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | N-benzyl-5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-methyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1noc([C@H](CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C23H32N4O4/c1-27(16-18-11-6-3-7-12-18)23(29)21-24-22(31-26-21)19(15-20(28)25-30)14-8-13-17-9-4-2-5-10-17/h3,6-7,11-12,17,19,30H,2,4-5,8-10,13-16H2,1H3,(H,25,28)/t19-/m1/s1 |
| InChIKey | JRIDLXYLYGFXAV-LJQANCHMSA-N |
| XLogP | 4.07 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|