C17H16N6S3 — CID 1018100
2-benzylsulfanyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-thiadiazole (PubChem CID 1018100) has the molecular formula C17H16N6S3 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-thiadiazole.
| Compound Name | 2-benzylsulfanyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 1018100 |
| Molecular Formula | C17H16N6S3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-benzylsulfanyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-thiadiazole |
| SMILES | Cc1cc(C)n2nc(SCc3nnc(SCc4ccccc4)s3)nc2n1 |
| InChI | InChI=1S/C17H16N6S3/c1-11-8-12(2)23-15(18-11)19-16(22-23)24-10-14-20-21-17(26-14)25-9-13-6-4-3-5-7-13/h3-8H,9-10H2,1-2H3 |
| InChIKey | TZYIETQVFMPXQR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |