C21H21F2N5OS — CID 10181040
[4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluorophenyl)methanone (PubChem CID 10181040) has the molecular formula C21H21F2N5OS and a molecular weight of 429.50 g/mol. Its IUPAC name is [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 10181040 |
| Molecular Formula | C21H21F2N5OS |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluorophenyl)methanone |
| SMILES | CN1CCN(c2ccc(Nc3nc(N)c(C(=O)c4cc(F)cc(F)c4)s3)cc2)CC1 |
| InChI | InChI=1S/C21H21F2N5OS/c1-27-6-8-28(9-7-27)17-4-2-16(3-5-17)25-21-26-20(24)19(30-21)18(29)13-10-14(22)12-15(23)11-13/h2-5,10-12H,6-9,24H2,1H3,(H,25,26) |
| InChIKey | LXHSTNBSSSUFFU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|