C22H18ClN7O — CID 10181189
2-[(2-amino-6-chloropurin-9-yl)methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one (PubChem CID 10181189) has the molecular formula C22H18ClN7O and a molecular weight of 431.89 g/mol. Its IUPAC name is 2-[(2-amino-6-chloropurin-9-yl)methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[(2-amino-6-chloropurin-9-yl)methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 10181189 |
| Molecular Formula | C22H18ClN7O |
| Molecular Weight | 431.89 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-[(2-amino-6-chloropurin-9-yl)methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(Cn2cnc3c(Cl)nc(N)nc32)nc2cccc(C)c2c1=O |
| InChI | InChI=1S/C22H18ClN7O/c1-12-6-3-4-9-15(12)30-16(26-14-8-5-7-13(2)17(14)21(30)31)10-29-11-25-18-19(23)27-22(24)28-20(18)29/h3-9,11H,10H2,1-2H3,(H2,24,27,28) |
| InChIKey | PGKGDAOZGPWYBX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |