C22H20BrN3S — CID 10181612
6-(4-bromothiophen-2-yl)-5,6,6a,7,8,12b-hexahydrobenzo[k]phenanthridine-2-carboximidamide (PubChem CID 10181612) has the molecular formula C22H20BrN3S and a molecular weight of 438.39 g/mol. Its IUPAC name is 6-(4-bromothiophen-2-yl)-5,6,6a,7,8,12b-hexahydrobenzo[k]phenanthridine-2-carboximidamide.
| Compound Name | 6-(4-bromothiophen-2-yl)-5,6,6a,7,8,12b-hexahydrobenzo[k]phenanthridine-2-carboximidamide |
|---|---|
| PubChem CID | 10181612 |
| Molecular Formula | C22H20BrN3S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 6-(4-bromothiophen-2-yl)-5,6,6a,7,8,12b-hexahydrobenzo[k]phenanthridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C1c3ccccc3CCC1C(c1cc(Br)cs1)N2 |
| InChI | InChI=1S/C22H20BrN3S/c23-14-10-19(27-11-14)21-16-7-5-12-3-1-2-4-15(12)20(16)17-9-13(22(24)25)6-8-18(17)26-21/h1-4,6,8-11,16,20-21,26H,5,7H2,(H3,24,25) |
| InChIKey | HYEZXDLKZYUMPI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|