About 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one
2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one (PubChem CID 10181691) has the molecular formula C26H21N3O2S
and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one |
| PubChem CID | 10181691 |
| Molecular Formula | C26H21N3O2S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one |
| SMILES | Cc1cc(C(O)c2cccs2)nc2c1c(=O)cc(Nc1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C26H21N3O2S/c1-17-15-20(25(31)22-13-8-14-32-22)28-26-24(17)21(30)16-23(27-18-9-4-2-5-10-18)29(26)19-11-6-3-7-12-19/h2-16,25,27,31H,1H3 |
| InChIKey | RVDUUVKZFTXGEU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one?
The IUPAC name of 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one (CID 10181691) is 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one.
What is the SMILES notation for 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one?
The canonical SMILES for 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one is Cc1cc(C(O)c2cccs2)nc2c1c(=O)cc(Nc1ccccc1)n2-c1ccccc1.
What is the InChIKey of 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one?
The InChIKey is RVDUUVKZFTXGEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N3O2S/c1-17-15-20(25(31)22-13-8-14-32-22)28-26-24(17)21(30)16-23(27-18-9-4-2-5-10-18)29(26)19-11-6-3-7-12-19/h2-16,25,27,31H,1H3.
What are the key properties of 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one?
2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one has a molecular weight of 439.54 g/mol, XLogP of 5.58, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-7-[hydroxy(thiophen-2-yl)methyl]-5-methyl-1-phenyl-1,8-naphthyridin-4-one is sourced from PubChem (CID 10181691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).