C16H24O14 — CID 10181725
(2S,3S,11S,12S)-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3,11,12-tetracarboxylic acid (PubChem CID 10181725) has the molecular formula C16H24O14 and a molecular weight of 440.35 g/mol. Its IUPAC name is (2S,3S,11S,12S)-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3,11,12-tetracarboxylic acid.
| Compound Name | (2S,3S,11S,12S)-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3,11,12-tetracarboxylic acid |
|---|---|
| PubChem CID | 10181725 |
| Molecular Formula | C16H24O14 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (2S,3S,11S,12S)-1,4,7,10,13,16-hexaoxacyclooctadecane-2,3,11,12-tetracarboxylic acid |
| SMILES | O=C(O)[C@H]1OCCOCCO[C@H](C(=O)O)[C@@H](C(=O)O)OCCOCCO[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H24O14/c17-13(18)9-10(14(19)20)29-7-3-26-4-8-30-12(16(23)24)11(15(21)22)28-6-2-25-1-5-27-9/h9-12H,1-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | FZERLKNAJSFDSQ-BJDJZHNGSA-N |
| XLogP | -2.09 |
| TPSA | 204.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |