C19H24F6N2O3 — CID 10181847
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-pentylmorpholine-4-carboxamide (PubChem CID 10181847) has the molecular formula C19H24F6N2O3 and a molecular weight of 442.40 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-pentylmorpholine-4-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-pentylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 10181847 |
| Molecular Formula | C19H24F6N2O3 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-pentylmorpholine-4-carboxamide |
| SMILES | CCCCCN(C(=O)N1CCOCC1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H24F6N2O3/c1-2-3-4-9-27(16(28)26-10-12-30-13-11-26)15-7-5-14(6-8-15)17(29,18(20,21)22)19(23,24)25/h5-8,29H,2-4,9-13H2,1H3 |
| InChIKey | IQMBNDWOOAIOLL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|