C25H16F3NO2S — CID 10182445
3-(1-benzothiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid (PubChem CID 10182445) has the molecular formula C25H16F3NO2S and a molecular weight of 451.47 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid.
| Compound Name | 3-(1-benzothiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 10182445 |
| Molecular Formula | C25H16F3NO2S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(-c2cc3ccccc3s2)c2ccccc2n1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H16F3NO2S/c26-25(27,28)17-8-5-6-15(12-17)14-29-19-10-3-2-9-18(19)22(23(29)24(30)31)21-13-16-7-1-4-11-20(16)32-21/h1-13H,14H2,(H,30,31) |
| InChIKey | MLAVDCBQBSLKEQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |