C20H29N5O5S — CID 10182462
(3R)-6-cyclohexyl-N-hydroxy-3-[3-[(pyridin-3-ylsulfonylamino)methyl]-1,2,4-oxadiazol-5-yl]hexanamide (PubChem CID 10182462) has the molecular formula C20H29N5O5S and a molecular weight of 451.55 g/mol. Its IUPAC name is (3R)-6-cyclohexyl-N-hydroxy-3-[3-[(pyridin-3-ylsulfonylamino)methyl]-1,2,4-oxadiazol-5-yl]hexanamide.
| Compound Name | (3R)-6-cyclohexyl-N-hydroxy-3-[3-[(pyridin-3-ylsulfonylamino)methyl]-1,2,4-oxadiazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 10182462 |
| Molecular Formula | C20H29N5O5S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (3R)-6-cyclohexyl-N-hydroxy-3-[3-[(pyridin-3-ylsulfonylamino)methyl]-1,2,4-oxadiazol-5-yl]hexanamide |
| SMILES | O=C(C[C@@H](CCCC1CCCCC1)c1nc(CNS(=O)(=O)c2cccnc2)no1)NO |
| InChI | InChI=1S/C20H29N5O5S/c26-19(24-27)12-16(9-4-8-15-6-2-1-3-7-15)20-23-18(25-30-20)14-22-31(28,29)17-10-5-11-21-13-17/h5,10-11,13,15-16,22,27H,1-4,6-9,12,14H2,(H,24,26)/t16-/m1/s1 |
| InChIKey | QSFKIQZVLNUDND-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|