C20H21N3O6S2 — CID 10183222
N-[3-(2,4-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-1-yl)propyl]-N-methyl-2-oxochromene-6-sulfonamide (PubChem CID 10183222) has the molecular formula C20H21N3O6S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[3-(2,4-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-1-yl)propyl]-N-methyl-2-oxochromene-6-sulfonamide.
| Compound Name | N-[3-(2,4-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-1-yl)propyl]-N-methyl-2-oxochromene-6-sulfonamide |
|---|---|
| PubChem CID | 10183222 |
| Molecular Formula | C20H21N3O6S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-[3-(2,4-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-1-yl)propyl]-N-methyl-2-oxochromene-6-sulfonamide |
| SMILES | CN(CCCn1c2c(c(=O)[nH]c1=O)CSCC2)S(=O)(=O)c1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C20H21N3O6S2/c1-22(31(27,28)14-4-5-17-13(11-14)3-6-18(24)29-17)8-2-9-23-16-7-10-30-12-15(16)19(25)21-20(23)26/h3-6,11H,2,7-10,12H2,1H3,(H,21,25,26) |
| InChIKey | YCGNMCXACBSBHO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|