C25H22ClN7O — CID 10183783
6-benzyl-2-N-[5-chloro-2-[(1-oxidopyridin-1-ium-2-yl)methyl]phenyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2,7-diamine (PubChem CID 10183783) has the molecular formula C25H22ClN7O and a molecular weight of 471.95 g/mol. Its IUPAC name is 6-benzyl-2-N-[5-chloro-2-[(1-oxidopyridin-1-ium-2-yl)methyl]phenyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2,7-diamine.
| Compound Name | 6-benzyl-2-N-[5-chloro-2-[(1-oxidopyridin-1-ium-2-yl)methyl]phenyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 10183783 |
| Molecular Formula | C25H22ClN7O |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 6-benzyl-2-N-[5-chloro-2-[(1-oxidopyridin-1-ium-2-yl)methyl]phenyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2,7-diamine |
| SMILES | Cc1nc2nc(Nc3cc(Cl)ccc3Cc3cccc[n+]3[O-])nn2c(N)c1Cc1ccccc1 |
| InChI | InChI=1S/C25H22ClN7O/c1-16-21(13-17-7-3-2-4-8-17)23(27)33-25(28-16)30-24(31-33)29-22-15-19(26)11-10-18(22)14-20-9-5-6-12-32(20)34/h2-12,15H,13-14,27H2,1H3,(H,29,31) |
| InChIKey | IKARJSHZGNCRDV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|