C25H26F3N5O2 — CID 10184624
N-[6-[3-(dimethylcarbamoylamino)propylamino]-3-pyridinyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 10184624) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is N-[6-[3-(dimethylcarbamoylamino)propylamino]-3-pyridinyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[6-[3-(dimethylcarbamoylamino)propylamino]-3-pyridinyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10184624 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[6-[3-(dimethylcarbamoylamino)propylamino]-3-pyridinyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN(C)C(=O)NCCCNc1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C25H26F3N5O2/c1-33(2)24(35)30-15-5-14-29-22-13-12-19(16-31-22)32-23(34)21-7-4-3-6-20(21)17-8-10-18(11-9-17)25(26,27)28/h3-4,6-13,16H,5,14-15H2,1-2H3,(H,29,31)(H,30,35)(H,32,34) |
| InChIKey | KIJXISKXTSTFGQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|