C31H35FN2O2 — CID 10184693
(4-fluorophenyl)-[4-[2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3H-1-benzofuran-5-yl]piperazin-1-yl]methanone (PubChem CID 10184693) has the molecular formula C31H35FN2O2 and a molecular weight of 486.63 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-[2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3H-1-benzofuran-5-yl]piperazin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-[2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3H-1-benzofuran-5-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 10184693 |
| Molecular Formula | C31H35FN2O2 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | (4-fluorophenyl)-[4-[2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3H-1-benzofuran-5-yl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C2c3c(C)c(N4CCN(C(=O)c5ccc(F)cc5)CC4)c(C)c(C)c3OC2(C)C)cc1 |
| InChI | InChI=1S/C31H35FN2O2/c1-19-7-9-23(10-8-19)27-26-22(4)28(20(2)21(3)29(26)36-31(27,5)6)33-15-17-34(18-16-33)30(35)24-11-13-25(32)14-12-24/h7-14,27H,15-18H2,1-6H3 |
| InChIKey | UIKPSNYBWUOTEJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|