About benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate
benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate (PubChem CID 10184725) has the molecular formula C28H23F2N3O3
and a molecular weight of 487.51 g/mol. Its IUPAC name is benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate |
| PubChem CID | 10184725 |
| Molecular Formula | C28H23F2N3O3 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccccc1-c1cccc(C(=O)NCc2ccc(F)cc2F)n1)OCc1ccccc1 |
| InChI | InChI=1S/C28H23F2N3O3/c29-22-14-13-21(24(30)15-22)17-31-27(34)26-12-6-11-25(33-26)23-10-5-4-9-20(23)16-32-28(35)36-18-19-7-2-1-3-8-19/h1-15H,16-18H2,(H,31,34)(H,32,35) |
| InChIKey | ZKWJHRFLYPMSJJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate?
The IUPAC name of benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate (CID 10184725) is benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate.
What is the SMILES notation for benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate?
The canonical SMILES for benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate is O=C(NCc1ccccc1-c1cccc(C(=O)NCc2ccc(F)cc2F)n1)OCc1ccccc1.
What is the InChIKey of benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate?
The InChIKey is ZKWJHRFLYPMSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23F2N3O3/c29-22-14-13-21(24(30)15-22)17-31-27(34)26-12-6-11-25(33-26)23-10-5-4-9-20(23)16-32-28(35)36-18-19-7-2-1-3-8-19/h1-15H,16-18H2,(H,31,34)(H,32,35).
What are the key properties of benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate?
benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate has a molecular weight of 487.51 g/mol, XLogP of 5.38, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[[2-[6-[(2,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]phenyl]methyl]carbamate is sourced from PubChem (CID 10184725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).