C25H26F2NO5P — CID 10184838
8-[bis(phenylmethoxy)phosphoryl-difluoromethyl]-3,3,5-trimethyl-2H-[1,4]dioxino[2,3-c]pyridine (PubChem CID 10184838) has the molecular formula C25H26F2NO5P and a molecular weight of 489.46 g/mol. Its IUPAC name is 8-[bis(phenylmethoxy)phosphoryl-difluoromethyl]-3,3,5-trimethyl-2H-[1,4]dioxino[2,3-c]pyridine.
| Compound Name | 8-[bis(phenylmethoxy)phosphoryl-difluoromethyl]-3,3,5-trimethyl-2H-[1,4]dioxino[2,3-c]pyridine |
|---|---|
| PubChem CID | 10184838 |
| Molecular Formula | C25H26F2NO5P |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 8-[bis(phenylmethoxy)phosphoryl-difluoromethyl]-3,3,5-trimethyl-2H-[1,4]dioxino[2,3-c]pyridine |
| SMILES | Cc1ncc(C(F)(F)P(=O)(OCc2ccccc2)OCc2ccccc2)c2c1OC(C)(C)CO2 |
| InChI | InChI=1S/C25H26F2NO5P/c1-18-22-23(30-17-24(2,3)33-22)21(14-28-18)25(26,27)34(29,31-15-19-10-6-4-7-11-19)32-16-20-12-8-5-9-13-20/h4-14H,15-17H2,1-3H3 |
| InChIKey | OVMDWKVNNSBEQU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|