C23H24Cl2N6O3 — CID 10185509
N-[(3,5-dichlorophenyl)methyl]-5-[4-(2-formamidoethyl)piperazin-1-yl]-8-hydroxy-1,6-naphthyridine-7-carboxamide (PubChem CID 10185509) has the molecular formula C23H24Cl2N6O3 and a molecular weight of 503.39 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-5-[4-(2-formamidoethyl)piperazin-1-yl]-8-hydroxy-1,6-naphthyridine-7-carboxamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-5-[4-(2-formamidoethyl)piperazin-1-yl]-8-hydroxy-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 10185509 |
| Molecular Formula | C23H24Cl2N6O3 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-5-[4-(2-formamidoethyl)piperazin-1-yl]-8-hydroxy-1,6-naphthyridine-7-carboxamide |
| SMILES | O=CNCCN1CCN(c2nc(C(=O)NCc3cc(Cl)cc(Cl)c3)c(O)c3ncccc23)CC1 |
| InChI | InChI=1S/C23H24Cl2N6O3/c24-16-10-15(11-17(25)12-16)13-28-23(34)20-21(33)19-18(2-1-3-27-19)22(29-20)31-8-6-30(7-9-31)5-4-26-14-32/h1-3,10-12,14,33H,4-9,13H2,(H,26,32)(H,28,34) |
| InChIKey | SDOIAASCQIEZST-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|