C33H32N2O3 — CID 10185598
N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-5-phenylpentanamide (PubChem CID 10185598) has the molecular formula C33H32N2O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-5-phenylpentanamide.
| Compound Name | N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 10185598 |
| Molecular Formula | C33H32N2O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-5-phenylpentanamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(NC(=O)CCCCc3ccccc3)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H32N2O3/c1-24-16-18-26(19-17-24)22-32(37)35-30-21-20-28(23-29(30)33(38)27-13-6-3-7-14-27)34-31(36)15-9-8-12-25-10-4-2-5-11-25/h2-7,10-11,13-14,16-21,23H,8-9,12,15,22H2,1H3,(H,34,36)(H,35,37) |
| InChIKey | DEWWXXMPBVZWTK-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|