C17H24N4O10S2 — CID 10185774
(2R,3R,4S)-3-acetamido-4-[(2-acetamido-4-methyl-1,3-thiazol-5-yl)sulfonylamino]-2-[(1R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 10185774) has the molecular formula C17H24N4O10S2 and a molecular weight of 508.53 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[(2-acetamido-4-methyl-1,3-thiazol-5-yl)sulfonylamino]-2-[(1R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[(2-acetamido-4-methyl-1,3-thiazol-5-yl)sulfonylamino]-2-[(1R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 10185774 |
| Molecular Formula | C17H24N4O10S2 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[(2-acetamido-4-methyl-1,3-thiazol-5-yl)sulfonylamino]-2-[(1R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)Nc1nc(C)c(S(=O)(=O)N[C@H]2C=C(C(=O)O)O[C@@H]([C@H](O)C(O)CO)[C@@H]2NC(C)=O)s1 |
| InChI | InChI=1S/C17H24N4O10S2/c1-6-16(32-17(18-6)20-8(3)24)33(29,30)21-9-4-11(15(27)28)31-14(12(9)19-7(2)23)13(26)10(25)5-22/h4,9-10,12-14,21-22,25-26H,5H2,1-3H3,(H,19,23)(H,27,28)(H,18,20,24)/t9-,10?,12+,13+,14+/m0/s1 |
| InChIKey | NJBUZKGSIKGFHK-IRHIWRJQSA-N |
| XLogP | -2.36 |
| TPSA | 224.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |