C26H23N3O4S — CID 1018595
3-[2,5-dimethyl-3-[[1-(3-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]-2-methylbenzoic acid (PubChem CID 1018595) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is 3-[2,5-dimethyl-3-[[1-(3-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]-2-methylbenzoic acid.
| Compound Name | 3-[2,5-dimethyl-3-[[1-(3-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 1018595 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 3-[2,5-dimethyl-3-[[1-(3-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]-2-methylbenzoic acid |
| SMILES | Cc1cccc(N2C(=O)C(=Cc3cc(C)n(-c4cccc(C(=O)O)c4C)c3C)C(=O)NC2=S)c1 |
| InChI | InChI=1S/C26H23N3O4S/c1-14-7-5-8-19(11-14)29-24(31)21(23(30)27-26(29)34)13-18-12-15(2)28(17(18)4)22-10-6-9-20(16(22)3)25(32)33/h5-13H,1-4H3,(H,32,33)(H,27,30,34) |
| InChIKey | QFSJAMUAFAQLGX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|