C29H27F4N3O2 — CID 10186528
(2,6-difluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate (PubChem CID 10186528) has the molecular formula C29H27F4N3O2 and a molecular weight of 525.55 g/mol. Its IUPAC name is (2,6-difluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate.
| Compound Name | (2,6-difluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 10186528 |
| Molecular Formula | C29H27F4N3O2 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | (2,6-difluorophenyl) N-[6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexyl]carbamate |
| SMILES | Cc1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CCCCCCNC(=O)Oc1c(F)cccc1F |
| InChI | InChI=1S/C29H27F4N3O2/c1-19-35-26(20-9-13-22(30)14-10-20)27(21-11-15-23(31)16-12-21)36(19)18-5-3-2-4-17-34-29(37)38-28-24(32)7-6-8-25(28)33/h6-16H,2-5,17-18H2,1H3,(H,34,37) |
| InChIKey | FTFMPYWXZDLNAM-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|