C27H24F7NO2 — CID 10186606
1,1,1-trifluoro-3-[N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol (PubChem CID 10186606) has the molecular formula C27H24F7NO2 and a molecular weight of 527.48 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol |
|---|---|
| PubChem CID | 10186606 |
| Molecular Formula | C27H24F7NO2 |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol |
| SMILES | OC(CN(Cc1cc(C(F)(F)F)ccc1F)c1cccc(Oc2ccc3c(c2)CCCC3)c1)C(F)(F)F |
| InChI | InChI=1S/C27H24F7NO2/c28-24-11-9-20(26(29,30)31)12-19(24)15-35(16-25(36)27(32,33)34)21-6-3-7-22(14-21)37-23-10-8-17-4-1-2-5-18(17)13-23/h3,6-14,25,36H,1-2,4-5,15-16H2 |
| InChIKey | HXGBMBRGLFKZLL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |