C24H17N3O7S — CID 10186636
9-hydroxy-2-[2-methoxy-4-(3-nitrophenyl)phenyl]-3H-benzo[e]benzimidazole-5-sulfonic acid (PubChem CID 10186636) has the molecular formula C24H17N3O7S and a molecular weight of 491.48 g/mol. Its IUPAC name is 9-hydroxy-2-[2-methoxy-4-(3-nitrophenyl)phenyl]-3H-benzo[e]benzimidazole-5-sulfonic acid.
| Compound Name | 9-hydroxy-2-[2-methoxy-4-(3-nitrophenyl)phenyl]-3H-benzo[e]benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 10186636 |
| Molecular Formula | C24H17N3O7S |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 9-hydroxy-2-[2-methoxy-4-(3-nitrophenyl)phenyl]-3H-benzo[e]benzimidazole-5-sulfonic acid |
| SMILES | COc1cc(-c2cccc([N+](=O)[O-])c2)ccc1-c1nc2c(cc(S(=O)(=O)O)c3cccc(O)c32)[nH]1 |
| InChI | InChI=1S/C24H17N3O7S/c1-34-20-11-14(13-4-2-5-15(10-13)27(29)30)8-9-16(20)24-25-18-12-21(35(31,32)33)17-6-3-7-19(28)22(17)23(18)26-24/h2-12,28H,1H3,(H,25,26)(H,31,32,33) |
| InChIKey | HXTSWUNPESFVJL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 155.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|