C35H45N3O2 — CID 10187155
1-(4-methoxyphenyl)-4-[2,2,4,6,7-pentamethyl-3-(4-phenylpiperidin-1-yl)-3H-1-benzofuran-5-yl]piperazine (PubChem CID 10187155) has the molecular formula C35H45N3O2 and a molecular weight of 539.76 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[2,2,4,6,7-pentamethyl-3-(4-phenylpiperidin-1-yl)-3H-1-benzofuran-5-yl]piperazine.
| Compound Name | 1-(4-methoxyphenyl)-4-[2,2,4,6,7-pentamethyl-3-(4-phenylpiperidin-1-yl)-3H-1-benzofuran-5-yl]piperazine |
|---|---|
| PubChem CID | 10187155 |
| Molecular Formula | C35H45N3O2 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[2,2,4,6,7-pentamethyl-3-(4-phenylpiperidin-1-yl)-3H-1-benzofuran-5-yl]piperazine |
| SMILES | COc1ccc(N2CCN(c3c(C)c(C)c4c(c3C)C(N3CCC(c5ccccc5)CC3)C(C)(C)O4)CC2)cc1 |
| InChI | InChI=1S/C35H45N3O2/c1-24-25(2)33-31(26(3)32(24)37-22-20-36(21-23-37)29-12-14-30(39-6)15-13-29)34(35(4,5)40-33)38-18-16-28(17-19-38)27-10-8-7-9-11-27/h7-15,28,34H,16-23H2,1-6H3 |
| InChIKey | RLOKQDUQBDVLBW-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|