C31H31NO8 — CID 10187365
1-(3,4-dimethoxyphenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-7,8-dimethoxychromeno[3,4-b]pyrrol-4-one (PubChem CID 10187365) has the molecular formula C31H31NO8 and a molecular weight of 545.59 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-7,8-dimethoxychromeno[3,4-b]pyrrol-4-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-7,8-dimethoxychromeno[3,4-b]pyrrol-4-one |
|---|---|
| PubChem CID | 10187365 |
| Molecular Formula | C31H31NO8 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-7,8-dimethoxychromeno[3,4-b]pyrrol-4-one |
| SMILES | COc1ccc(CCn2cc(-c3ccc(OC)c(OC)c3)c3c4cc(OC)c(OC)cc4oc(=O)c32)cc1OC |
| InChI | InChI=1S/C31H31NO8/c1-34-22-9-7-18(13-25(22)36-3)11-12-32-17-21(19-8-10-23(35-2)26(14-19)37-4)29-20-15-27(38-5)28(39-6)16-24(20)40-31(33)30(29)32/h7-10,13-17H,11-12H2,1-6H3 |
| InChIKey | NACJRCSRBMFCJQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 90.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|