C32H34F2N2O2S — CID 10187471
(4S)-4-(3,4-difluorophenyl)-3-(6-spiro[piperidine-4,9'-thioxanthene]-1-ylhexyl)-1,3-oxazolidin-2-one (PubChem CID 10187471) has the molecular formula C32H34F2N2O2S and a molecular weight of 548.70 g/mol. Its IUPAC name is (4S)-4-(3,4-difluorophenyl)-3-(6-spiro[piperidine-4,9'-thioxanthene]-1-ylhexyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(3,4-difluorophenyl)-3-(6-spiro[piperidine-4,9'-thioxanthene]-1-ylhexyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10187471 |
| Molecular Formula | C32H34F2N2O2S |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (4S)-4-(3,4-difluorophenyl)-3-(6-spiro[piperidine-4,9'-thioxanthene]-1-ylhexyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](c2ccc(F)c(F)c2)N1CCCCCCN1CCC2(CC1)c1ccccc1Sc1ccccc12 |
| InChI | InChI=1S/C32H34F2N2O2S/c33-26-14-13-23(21-27(26)34)28-22-38-31(37)36(28)18-8-2-1-7-17-35-19-15-32(16-20-35)24-9-3-5-11-29(24)39-30-12-6-4-10-25(30)32/h3-6,9-14,21,28H,1-2,7-8,15-20,22H2/t28-/m1/s1 |
| InChIKey | JKWTZKUNVYCKDZ-MUUNZHRXSA-N |
| XLogP | 7.57 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|