C27H33ClN2O8 — CID 10187479
(2R)-2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]propanoic acid (PubChem CID 10187479) has the molecular formula C27H33ClN2O8 and a molecular weight of 549.02 g/mol. Its IUPAC name is (2R)-2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10187479 |
| Molecular Formula | C27H33ClN2O8 |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | (2R)-2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]propanoic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CC(=O)N[C@H](C)C(=O)O)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C27H33ClN2O8/c1-15(26(34)35)29-22(32)12-21-25(33)30(13-27(2,3)14-31)19-10-9-16(28)11-18(19)23(38-21)17-7-6-8-20(36-4)24(17)37-5/h6-11,15,21,23,31H,12-14H2,1-5H3,(H,29,32)(H,34,35)/t15-,21-,23-/m1/s1 |
| InChIKey | JCHYHJUTOPKYNB-YCASGBEESA-N |
| XLogP | 3.18 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |