C31H28N4O2S2 — CID 10187600
1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-bis(2-methylphenyl)propanedihydrazide (PubChem CID 10187600) has the molecular formula C31H28N4O2S2 and a molecular weight of 552.73 g/mol. Its IUPAC name is 1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-bis(2-methylphenyl)propanedihydrazide.
| Compound Name | 1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-bis(2-methylphenyl)propanedihydrazide |
|---|---|
| PubChem CID | 10187600 |
| Molecular Formula | C31H28N4O2S2 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-bis(2-methylphenyl)propanedihydrazide |
| SMILES | Cc1ccccc1N(NC(=O)CC(=O)NN(C(=S)c1ccccc1)c1ccccc1C)C(=S)c1ccccc1 |
| InChI | InChI=1S/C31H28N4O2S2/c1-22-13-9-11-19-26(22)34(30(38)24-15-5-3-6-16-24)32-28(36)21-29(37)33-35(27-20-12-10-14-23(27)2)31(39)25-17-7-4-8-18-25/h3-20H,21H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | OMPQJLODODJFLW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|