C26H30F6N6O — CID 10187704
1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine (PubChem CID 10187704) has the molecular formula C26H30F6N6O and a molecular weight of 556.56 g/mol. Its IUPAC name is 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine.
| Compound Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine |
|---|---|
| PubChem CID | 10187704 |
| Molecular Formula | C26H30F6N6O |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine |
| SMILES | FC(F)(F)c1cc(COCC(c2ccccc2)N2CCN(CCCCc3nn[nH]n3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H30F6N6O/c27-25(28,29)21-14-19(15-22(16-21)26(30,31)32)17-39-18-23(20-6-2-1-3-7-20)38-12-10-37(11-13-38)9-5-4-8-24-33-35-36-34-24/h1-3,6-7,14-16,23H,4-5,8-13,17-18H2,(H,33,34,35,36) |
| InChIKey | VLROGTSVMJUONC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|