C27H32N4O7S — CID 10187714
3-[[4-[4-(dimethylamino)butanoylamino]-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-oxobutanoic acid (PubChem CID 10187714) has the molecular formula C27H32N4O7S and a molecular weight of 556.64 g/mol. Its IUPAC name is 3-[[4-[4-(dimethylamino)butanoylamino]-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-oxobutanoic acid.
| Compound Name | 3-[[4-[4-(dimethylamino)butanoylamino]-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10187714 |
| Molecular Formula | C27H32N4O7S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 3-[[4-[4-(dimethylamino)butanoylamino]-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-oxobutanoic acid |
| SMILES | CN(C)CCCC(=O)Nc1ccc(S(=O)(=O)NC(C=O)CC(=O)O)c(OCCc2cccc3ncccc23)c1 |
| InChI | InChI=1S/C27H32N4O7S/c1-31(2)14-5-9-26(33)29-20-10-11-25(39(36,37)30-21(18-32)17-27(34)35)24(16-20)38-15-12-19-6-3-8-23-22(19)7-4-13-28-23/h3-4,6-8,10-11,13,16,18,21,30H,5,9,12,14-15,17H2,1-2H3,(H,29,33)(H,34,35) |
| InChIKey | CLIUKPKINVXQTL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|