C28H26IN3O2 — CID 10187947
(E)-3-(8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)-1-morpholin-4-ylprop-2-en-1-one iodide (PubChem CID 10187947) has the molecular formula C28H26IN3O2 and a molecular weight of 563.44 g/mol. Its IUPAC name is (E)-3-(8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)-1-morpholin-4-ylprop-2-en-1-one iodide.
| Compound Name | (E)-3-(8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)-1-morpholin-4-ylprop-2-en-1-one iodide |
|---|---|
| PubChem CID | 10187947 |
| Molecular Formula | C28H26IN3O2 |
| Molecular Weight | 563.44 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | (E)-3-(8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)-1-morpholin-4-ylprop-2-en-1-one iodide |
| SMILES | CN1c2ccccc2-c2c3c1cccc3c1cc(/C=C/C(=O)N3CCOCC3)ccc1[n+]2C.[I-] |
| InChI | InChI=1S/C28H26N3O2.HI/c1-29-23-8-4-3-6-21(23)28-27-20(7-5-9-25(27)29)22-18-19(10-12-24(22)30(28)2)11-13-26(32)31-14-16-33-17-15-31;/h3-13,18H,14-17H2,1-2H3;1H/q+1;/p-1/b13-11+; |
| InChIKey | VAELHQMDQRBTKH-BNSHTTSQSA-M |
| XLogP | 1.44 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|