C29H30F3N7O2 — CID 10188014
3-[2-[3-[(6-methoxy-3-pyridinyl)amino]-1H-pyrazol-5-yl]ethyl]-N-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 10188014) has the molecular formula C29H30F3N7O2 and a molecular weight of 565.60 g/mol. Its IUPAC name is 3-[2-[3-[(6-methoxy-3-pyridinyl)amino]-1H-pyrazol-5-yl]ethyl]-N-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-[3-[(6-methoxy-3-pyridinyl)amino]-1H-pyrazol-5-yl]ethyl]-N-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10188014 |
| Molecular Formula | C29H30F3N7O2 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 3-[2-[3-[(6-methoxy-3-pyridinyl)amino]-1H-pyrazol-5-yl]ethyl]-N-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1ccc(Nc2cc(CCc3cccc(C(=O)Nc4ccc(N5CCNCC5)c(C(F)(F)F)c4)c3)[nH]n2)cn1 |
| InChI | InChI=1S/C29H30F3N7O2/c1-41-27-10-8-23(18-34-27)35-26-17-22(37-38-26)6-5-19-3-2-4-20(15-19)28(40)36-21-7-9-25(24(16-21)29(30,31)32)39-13-11-33-12-14-39/h2-4,7-10,15-18,33H,5-6,11-14H2,1H3,(H,36,40)(H2,35,37,38) |
| InChIKey | QZWZUYUZAKOUIZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|