About 6-Benzyl-1,4-dihydroxypyridin-2-one
6-Benzyl-1,4-dihydroxypyridin-2-one (PubChem CID 101884792) has the molecular formula C12H11NO3
and a molecular weight of 217.22 g/mol. Its IUPAC name is 6-benzyl-1,4-dihydroxypyridin-2-one.
Molecular Properties
| Compound Name | 6-Benzyl-1,4-dihydroxypyridin-2-one |
| PubChem CID | 101884792 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 6-benzyl-1,4-dihydroxypyridin-2-one |
| SMILES | C1=CC=C(C=C1)CC2=CC(=CC(=O)N2O)O |
| InChI | InChI=1S/C12H11NO3/c14-11-7-10(13(16)12(15)8-11)6-9-4-2-1-3-5-9/h1-5,7-8,14,16H,6H2 |
| InChIKey | FFONDJMUEULHQI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 60.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 340 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-Benzyl-1,4-dihydroxypyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-Benzyl-1,4-dihydroxypyridin-2-one?
The IUPAC name of 6-Benzyl-1,4-dihydroxypyridin-2-one (CID 101884792) is 6-benzyl-1,4-dihydroxypyridin-2-one.
What is the SMILES notation for 6-Benzyl-1,4-dihydroxypyridin-2-one?
The canonical SMILES for 6-Benzyl-1,4-dihydroxypyridin-2-one is C1=CC=C(C=C1)CC2=CC(=CC(=O)N2O)O.
What is the InChIKey of 6-Benzyl-1,4-dihydroxypyridin-2-one?
The InChIKey is FFONDJMUEULHQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3/c14-11-7-10(13(16)12(15)8-11)6-9-4-2-1-3-5-9/h1-5,7-8,14,16H,6H2.
What are the key properties of 6-Benzyl-1,4-dihydroxypyridin-2-one?
6-Benzyl-1,4-dihydroxypyridin-2-one has a molecular weight of 217.22 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-Benzyl-1,4-dihydroxypyridin-2-one is sourced from PubChem (CID 101884792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).