C37H40F3N3O2 — CID 10189206
N-[4-[4-[2,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 10189206) has the molecular formula C37H40F3N3O2 and a molecular weight of 615.74 g/mol. Its IUPAC name is N-[4-[4-[2,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-[2,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10189206 |
| Molecular Formula | C37H40F3N3O2 |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | N-[4-[4-[2,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cc(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CC2)c(C)cc1OCc1ccccn1 |
| InChI | InChI=1S/C37H40F3N3O2/c1-26-24-35(45-25-33-7-3-4-18-41-33)27(2)23-34(26)30-16-21-43(22-17-30)20-6-5-19-42-36(44)31-10-8-28(9-11-31)29-12-14-32(15-13-29)37(38,39)40/h3-4,7-15,18,23-24,30H,5-6,16-17,19-22,25H2,1-2H3,(H,42,44) |
| InChIKey | HLAQXAJGJBSBQS-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|