About 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one
3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one (PubChem CID 101894417) has the molecular formula C18H28O5
and a molecular weight of 324.40 g/mol. Its IUPAC name is 3,4-dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one.
Molecular Properties
| Compound Name | 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one |
| PubChem CID | 101894417 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 3,4-dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one |
| SMILES | CCCCOC1=C(C(=O)C1(OCCCC)OCC=C)OCC=C |
| InChI | InChI=1S/C18H28O5/c1-5-9-13-21-17-15(20-11-7-3)16(19)18(17,22-12-8-4)23-14-10-6-2/h7-8H,3-6,9-14H2,1-2H3 |
| InChIKey | ZCLRXYZPVVUXOZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | 441 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one?
The IUPAC name of 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one (CID 101894417) is 3,4-dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one.
What is the SMILES notation for 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one?
The canonical SMILES for 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one is CCCCOC1=C(C(=O)C1(OCCCC)OCC=C)OCC=C.
What is the InChIKey of 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one?
The InChIKey is ZCLRXYZPVVUXOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O5/c1-5-9-13-21-17-15(20-11-7-3)16(19)18(17,22-12-8-4)23-14-10-6-2/h7-8H,3-6,9-14H2,1-2H3.
What are the key properties of 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one?
3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one has a molecular weight of 324.40 g/mol, XLogP of 3.70, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-Dibutoxy-2,4-bis(prop-2-enoxy)cyclobut-2-en-1-one is sourced from PubChem (CID 101894417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).