C18H21ClI2N2O4S — CID 10189767
N-[1-[(3,5-diiodo-4-methoxyphenyl)methyl]-6-hydroxy-1,2,3,4-tetrahydroisoquinolin-7-yl]methanesulfonamide;hydrochloride (PubChem CID 10189767) has the molecular formula C18H21ClI2N2O4S and a molecular weight of 650.70 g/mol. Its IUPAC name is N-[1-[(3,5-diiodo-4-methoxyphenyl)methyl]-6-hydroxy-1,2,3,4-tetrahydroisoquinolin-7-yl]methanesulfonamide;hydrochloride.
| Compound Name | N-[1-[(3,5-diiodo-4-methoxyphenyl)methyl]-6-hydroxy-1,2,3,4-tetrahydroisoquinolin-7-yl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 10189767 |
| Molecular Formula | C18H21ClI2N2O4S |
| Molecular Weight | 650.70 g/mol |
| Exact Mass | 649.90 |
| IUPAC Name | N-[1-[(3,5-diiodo-4-methoxyphenyl)methyl]-6-hydroxy-1,2,3,4-tetrahydroisoquinolin-7-yl]methanesulfonamide;hydrochloride |
| SMILES | COc1c(I)cc(CC2NCCc3cc(O)c(NS(C)(=O)=O)cc32)cc1I.Cl |
| InChI | InChI=1S/C18H20I2N2O4S.ClH/c1-26-18-13(19)5-10(6-14(18)20)7-15-12-9-16(22-27(2,24)25)17(23)8-11(12)3-4-21-15;/h5-6,8-9,15,21-23H,3-4,7H2,1-2H3;1H |
| InChIKey | IGPFAJMSKISCMI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.70 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|