C29H20N6O8S — CID 10189862
4-[[4-[4-[(2E)-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylic acid (PubChem CID 10189862) has the molecular formula C29H20N6O8S and a molecular weight of 612.58 g/mol. Its IUPAC name is 4-[[4-[4-[(2E)-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylic acid.
| Compound Name | 4-[[4-[4-[(2E)-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 10189862 |
| Molecular Formula | C29H20N6O8S |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | 4-[[4-[4-[(2E)-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)C1=C/C(=N/Nc2ccc(-c3ccc(/N=N/c4cn(-c5ccc(S(=O)(=O)O)cc5)nc4C(=O)O)cc3)cc2)C=CC1=O |
| InChI | InChI=1S/C29H20N6O8S/c36-26-14-9-21(15-24(26)28(37)38)32-30-19-5-1-17(2-6-19)18-3-7-20(8-4-18)31-33-25-16-35(34-27(25)29(39)40)22-10-12-23(13-11-22)44(41,42)43/h1-16,30H,(H,37,38)(H,39,40)(H,41,42,43)/b32-21+,33-31+ |
| InChIKey | PVHSMTIECAMZFA-AXIPGRPQSA-N |
| XLogP | 4.82 |
| TPSA | 212.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|